C9H20S4 — CID 129044926
2-ethyl-3-(2-sulfanylethylsulfanylmethyl)butane-1,4-dithiol (PubChem CID 129044926) has the molecular formula C9H20S4 and a molecular weight of 256.53 g/mol. Its IUPAC name is 2-ethyl-3-(2-sulfanylethylsulfanylmethyl)butane-1,4-dithiol.
| Compound Name | 2-ethyl-3-(2-sulfanylethylsulfanylmethyl)butane-1,4-dithiol |
|---|---|
| PubChem CID | 129044926 |
| Molecular Formula | C9H20S4 |
| Molecular Weight | 256.53 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-ethyl-3-(2-sulfanylethylsulfanylmethyl)butane-1,4-dithiol |
| SMILES | CCC(CS)C(CS)CSCCS |
| InChI | InChI=1S/C9H20S4/c1-2-8(5-11)9(6-12)7-13-4-3-10/h8-12H,2-7H2,1H3 |
| InChIKey | CQDSPMHNEZKLJK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|