C10H22S5 — CID 170090551
2-(1-ethylsulfanylpropan-2-ylsulfanyl)-3-(2-sulfanylethylsulfanyl)propane-1-thiol (PubChem CID 170090551) has the molecular formula C10H22S5 and a molecular weight of 302.62 g/mol. Its IUPAC name is 2-(1-ethylsulfanylpropan-2-ylsulfanyl)-3-(2-sulfanylethylsulfanyl)propane-1-thiol.
| Compound Name | 2-(1-ethylsulfanylpropan-2-ylsulfanyl)-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
|---|---|
| PubChem CID | 170090551 |
| Molecular Formula | C10H22S5 |
| Molecular Weight | 302.62 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-(1-ethylsulfanylpropan-2-ylsulfanyl)-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
| SMILES | CCSCC(C)SC(CS)CSCCS |
| InChI | InChI=1S/C10H22S5/c1-3-13-7-9(2)15-10(6-12)8-14-5-4-11/h9-12H,3-8H2,1-2H3 |
| InChIKey | HKACTPZNSARFRX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|