C8H18S4 — CID 20695357
2-propylsulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol (PubChem CID 20695357) has the molecular formula C8H18S4 and a molecular weight of 242.50 g/mol. Its IUPAC name is 2-propylsulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol.
| Compound Name | 2-propylsulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
|---|---|
| PubChem CID | 20695357 |
| Molecular Formula | C8H18S4 |
| Molecular Weight | 242.50 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-propylsulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
| SMILES | CCCSC(CS)CSCCS |
| InChI | InChI=1S/C8H18S4/c1-2-4-12-8(6-10)7-11-5-3-9/h8-10H,2-7H2,1H3 |
| InChIKey | JOJBMKIIGPCFIH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|