C9H20O2S5 — CID 141470064
2-[2,3-bis(2-sulfanylethylsulfanyl)propylsulfanyl]ethane-1,1-diol (PubChem CID 141470064) has the molecular formula C9H20O2S5 and a molecular weight of 320.59 g/mol. Its IUPAC name is 2-[2,3-bis(2-sulfanylethylsulfanyl)propylsulfanyl]ethane-1,1-diol.
| Compound Name | 2-[2,3-bis(2-sulfanylethylsulfanyl)propylsulfanyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 141470064 |
| Molecular Formula | C9H20O2S5 |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-[2,3-bis(2-sulfanylethylsulfanyl)propylsulfanyl]ethane-1,1-diol |
| SMILES | OC(O)CSCC(CSCCS)SCCS |
| InChI | InChI=1S/C9H20O2S5/c10-9(11)7-15-6-8(16-4-2-13)5-14-3-1-12/h8-13H,1-7H2 |
| InChIKey | BMQADWJYBIPUAU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|