C11H24N2OS6 — CID 175964697
2-[1-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-sulfanylpropan-2-yl]sulfanylethylthiourea (PubChem CID 175964697) has the molecular formula C11H24N2OS6 and a molecular weight of 392.73 g/mol. Its IUPAC name is 2-[1-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-sulfanylpropan-2-yl]sulfanylethylthiourea.
| Compound Name | 2-[1-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-sulfanylpropan-2-yl]sulfanylethylthiourea |
|---|---|
| PubChem CID | 175964697 |
| Molecular Formula | C11H24N2OS6 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-[1-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-sulfanylpropan-2-yl]sulfanylethylthiourea |
| SMILES | NC(=S)NCCSC(CS)CSCC(O)CSCCS |
| InChI | InChI=1S/C11H24N2OS6/c12-11(17)13-1-3-20-10(5-16)8-19-7-9(14)6-18-4-2-15/h9-10,14-16H,1-8H2,(H3,12,13,17) |
| InChIKey | ZUYRWWHROXRIHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|