C11H24N2OS6 — CID 153348231
[2-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-(2-sulfanylethylsulfanyl)propyl] carbamimidothioate (PubChem CID 153348231) has the molecular formula C11H24N2OS6 and a molecular weight of 392.73 g/mol. Its IUPAC name is [2-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-(2-sulfanylethylsulfanyl)propyl] carbamimidothioate.
| Compound Name | [2-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-(2-sulfanylethylsulfanyl)propyl] carbamimidothioate |
|---|---|
| PubChem CID | 153348231 |
| Molecular Formula | C11H24N2OS6 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [2-[2-hydroxy-3-(2-sulfanylethylsulfanyl)propyl]sulfanyl-3-(2-sulfanylethylsulfanyl)propyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(CSCCS)SCC(O)CSCCS |
| InChI | InChI=1S/C11H24N2OS6/c12-11(13)20-8-10(7-18-4-2-16)19-6-9(14)5-17-3-1-15/h9-10,14-16H,1-8H2,(H3,12,13) |
| InChIKey | WXVZKRCFFBUYDT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|