C5H12S5 — CID 155237339
3-(disulfanyl)-2-(2-sulfanylethylsulfanyl)propane-1-thiol (PubChem CID 155237339) has the molecular formula C5H12S5 and a molecular weight of 232.49 g/mol. Its IUPAC name is 3-(disulfanyl)-2-(2-sulfanylethylsulfanyl)propane-1-thiol.
| Compound Name | 3-(disulfanyl)-2-(2-sulfanylethylsulfanyl)propane-1-thiol |
|---|---|
| PubChem CID | 155237339 |
| Molecular Formula | C5H12S5 |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 3-(disulfanyl)-2-(2-sulfanylethylsulfanyl)propane-1-thiol |
| SMILES | SCCSC(CS)CSS |
| InChI | InChI=1S/C5H12S5/c6-1-2-9-5(3-7)4-10-8/h5-8H,1-4H2 |
| InChIKey | CIJSDOGROACFBW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|