C10H22S7 — CID 59055224
3-[(1E)-1-[methyl(sulfanylmethyl)-λ4-sulfanylidene]-3-sulfanylpropan-2-yl]sulfanyl-2-(2-sulfanylethylsulfanyl)propane-1-thiol (PubChem CID 59055224) has the molecular formula C10H22S7 and a molecular weight of 366.76 g/mol. Its IUPAC name is 3-[(1E)-1-[methyl(sulfanylmethyl)-λ4-sulfanylidene]-3-sulfanylpropan-2-yl]sulfanyl-2-(2-sulfanylethylsulfanyl)propane-1-thiol.
| Compound Name | 3-[(1E)-1-[methyl(sulfanylmethyl)-λ4-sulfanylidene]-3-sulfanylpropan-2-yl]sulfanyl-2-(2-sulfanylethylsulfanyl)propane-1-thiol |
|---|---|
| PubChem CID | 59055224 |
| Molecular Formula | C10H22S7 |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 3-[(1E)-1-[methyl(sulfanylmethyl)-λ4-sulfanylidene]-3-sulfanylpropan-2-yl]sulfanyl-2-(2-sulfanylethylsulfanyl)propane-1-thiol |
| SMILES | C/S(=C\C(CS)SCC(CS)SCCS)CS |
| InChI | InChI=1S/C10H22S7/c1-17(8-14)7-10(5-13)16-6-9(4-12)15-3-2-11/h7,9-14H,2-6,8H2,1H3 |
| InChIKey | CURVZNWAGQSEDP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|