C10H22S9 — CID 175012684
2-(2-sulfanylethylsulfanyl)-3-[[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]trisulfanyl]propane-1-thiol (PubChem CID 175012684) has the molecular formula C10H22S9 and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-(2-sulfanylethylsulfanyl)-3-[[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]trisulfanyl]propane-1-thiol.
| Compound Name | 2-(2-sulfanylethylsulfanyl)-3-[[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]trisulfanyl]propane-1-thiol |
|---|---|
| PubChem CID | 175012684 |
| Molecular Formula | C10H22S9 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 2-(2-sulfanylethylsulfanyl)-3-[[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]trisulfanyl]propane-1-thiol |
| SMILES | SCCSC(CS)CSSSCC(CS)SCCS |
| InChI | InChI=1S/C10H22S9/c11-1-3-15-9(5-13)7-17-19-18-8-10(6-14)16-4-2-12/h9-14H,1-8H2 |
| InChIKey | AHXQCSAVXPLXSP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|