C10H22O2S5 — CID 153325254
3-[3-(2-hydroxyethylsulfanyl)-2-sulfanylpropyl]sulfanyl-2-(2-sulfanylethylsulfanyl)propan-1-ol (PubChem CID 153325254) has the molecular formula C10H22O2S5 and a molecular weight of 334.62 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethylsulfanyl)-2-sulfanylpropyl]sulfanyl-2-(2-sulfanylethylsulfanyl)propan-1-ol.
| Compound Name | 3-[3-(2-hydroxyethylsulfanyl)-2-sulfanylpropyl]sulfanyl-2-(2-sulfanylethylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 153325254 |
| Molecular Formula | C10H22O2S5 |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-[3-(2-hydroxyethylsulfanyl)-2-sulfanylpropyl]sulfanyl-2-(2-sulfanylethylsulfanyl)propan-1-ol |
| SMILES | OCCSCC(S)CSCC(CO)SCCS |
| InChI | InChI=1S/C10H22O2S5/c11-1-3-15-6-9(14)7-16-8-10(5-12)17-4-2-13/h9-14H,1-8H2 |
| InChIKey | WDKHRAHZUHHTES-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|