C9H22N2OS2 — CID 86169687
2,3-bis(3-aminopropylsulfanyl)propan-1-ol (PubChem CID 86169687) has the molecular formula C9H22N2OS2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 2,3-bis(3-aminopropylsulfanyl)propan-1-ol.
| Compound Name | 2,3-bis(3-aminopropylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 86169687 |
| Molecular Formula | C9H22N2OS2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2,3-bis(3-aminopropylsulfanyl)propan-1-ol |
| SMILES | NCCCSCC(CO)SCCCN |
| InChI | InChI=1S/C9H22N2OS2/c10-3-1-5-13-8-9(7-12)14-6-2-4-11/h9,12H,1-8,10-11H2 |
| InChIKey | IEWKHFFJKMJUHL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|