C18H40S14 — CID 161244767
3-[2-[2,3-bis(sulfanyl)propylsulfanyl]-3-sulfanylpropyl]sulfanylpropane-1,2-dithiol (PubChem CID 161244767) has the molecular formula C18H40S14 and a molecular weight of 705.46 g/mol. Its IUPAC name is 3-[2-[2,3-bis(sulfanyl)propylsulfanyl]-3-sulfanylpropyl]sulfanylpropane-1,2-dithiol.
| Compound Name | 3-[2-[2,3-bis(sulfanyl)propylsulfanyl]-3-sulfanylpropyl]sulfanylpropane-1,2-dithiol |
|---|---|
| PubChem CID | 161244767 |
| Molecular Formula | C18H40S14 |
| Molecular Weight | 705.46 g/mol |
| Exact Mass | 703.92 |
| IUPAC Name | 3-[2-[2,3-bis(sulfanyl)propylsulfanyl]-3-sulfanylpropyl]sulfanylpropane-1,2-dithiol |
| SMILES | SCC(S)CSCC(CS)SCC(S)CS.SCC(S)CSCC(CS)SCC(S)CS |
| InChI | InChI=1S/2C9H20S7/c2*10-1-7(13)4-15-6-9(3-12)16-5-8(14)2-11/h2*7-14H,1-6H2 |
| InChIKey | VAMHXMGIXSIPDA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|