C9H20S8 — CID 23072578
3-[2,3-bis(sulfanyl)propylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]propane-1,2-dithiol (PubChem CID 23072578) has the molecular formula C9H20S8 and a molecular weight of 384.80 g/mol. Its IUPAC name is 3-[2,3-bis(sulfanyl)propylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]propane-1,2-dithiol.
| Compound Name | 3-[2,3-bis(sulfanyl)propylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]propane-1,2-dithiol |
|---|---|
| PubChem CID | 23072578 |
| Molecular Formula | C9H20S8 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 3-[2,3-bis(sulfanyl)propylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]propane-1,2-dithiol |
| SMILES | SCC(S)CSCSCSCSCC(S)CS |
| InChI | InChI=1S/C9H20S8/c10-1-8(12)3-14-5-16-7-17-6-15-4-9(13)2-11/h8-13H,1-7H2 |
| InChIKey | BOBHAVDSNSQEOY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|