C7H12O2S3 — CID 129193873
2,3-bis(sulfanyl)propylsulfanyl 2-methylprop-2-enoate (PubChem CID 129193873) has the molecular formula C7H12O2S3 and a molecular weight of 224.37 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)propylsulfanyl 2-methylprop-2-enoate.
| Compound Name | 2,3-bis(sulfanyl)propylsulfanyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129193873 |
| Molecular Formula | C7H12O2S3 |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2,3-bis(sulfanyl)propylsulfanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OSCC(S)CS |
| InChI | InChI=1S/C7H12O2S3/c1-5(2)7(8)9-12-4-6(11)3-10/h6,10-11H,1,3-4H2,2H3 |
| InChIKey | YLXURQBBGOJQSS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|