C4H10S5 — CID 141415810
1-(sulfanylmethylsulfanylmethylsulfanyl)ethane-1,2-dithiol (PubChem CID 141415810) has the molecular formula C4H10S5 and a molecular weight of 218.46 g/mol. Its IUPAC name is 1-(sulfanylmethylsulfanylmethylsulfanyl)ethane-1,2-dithiol.
| Compound Name | 1-(sulfanylmethylsulfanylmethylsulfanyl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 141415810 |
| Molecular Formula | C4H10S5 |
| Molecular Weight | 218.46 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | 1-(sulfanylmethylsulfanylmethylsulfanyl)ethane-1,2-dithiol |
| SMILES | SCSCSC(S)CS |
| InChI | InChI=1S/C4H10S5/c5-1-4(7)9-3-8-2-6/h4-7H,1-3H2 |
| InChIKey | QKMPRMIDBGIBAT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|