About 1-(disulfanyl)ethane-1,2-dithiol
1-(disulfanyl)ethane-1,2-dithiol (PubChem CID 174625480) has the molecular formula C2H6S4
and a molecular weight of 158.34 g/mol. Its IUPAC name is 1-(disulfanyl)ethane-1,2-dithiol.
Molecular Properties
| Compound Name | 1-(disulfanyl)ethane-1,2-dithiol |
| PubChem CID | 174625480 |
| Molecular Formula | C2H6S4 |
| Molecular Weight | 158.34 g/mol |
| Exact Mass | 157.94 |
| IUPAC Name | 1-(disulfanyl)ethane-1,2-dithiol |
| SMILES | SCC(S)SS |
| InChI | InChI=1S/C2H6S4/c3-1-2(4)6-5/h2-5H,1H2 |
| InChIKey | YAOOCLJZIGUUQF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)ethane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)ethane-1,2-dithiol?
The IUPAC name of 1-(disulfanyl)ethane-1,2-dithiol (CID 174625480) is 1-(disulfanyl)ethane-1,2-dithiol.
What is the SMILES notation for 1-(disulfanyl)ethane-1,2-dithiol?
The canonical SMILES for 1-(disulfanyl)ethane-1,2-dithiol is SCC(S)SS.
What is the InChIKey of 1-(disulfanyl)ethane-1,2-dithiol?
The InChIKey is YAOOCLJZIGUUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6S4/c3-1-2(4)6-5/h2-5H,1H2.
What are the key properties of 1-(disulfanyl)ethane-1,2-dithiol?
1-(disulfanyl)ethane-1,2-dithiol has a molecular weight of 158.34 g/mol, XLogP of 1.75, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)ethane-1,2-dithiol is sourced from PubChem (CID 174625480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).