About disulfanylmethanediol
disulfanylmethanediol (PubChem CID 91433290) has the molecular formula CH4O2S2
and a molecular weight of 112.17 g/mol. Its IUPAC name is disulfanylmethanediol.
Molecular Properties
| Compound Name | disulfanylmethanediol |
| PubChem CID | 91433290 |
| Molecular Formula | CH4O2S2 |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 111.97 |
| IUPAC Name | disulfanylmethanediol |
| SMILES | OC(O)SS |
| InChI | InChI=1S/CH4O2S2/c2-1(3)5-4/h1-4H |
| InChIKey | BDHGBFLGXFJYDH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disulfanylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfanylmethanediol?
The IUPAC name of disulfanylmethanediol (CID 91433290) is disulfanylmethanediol.
What is the SMILES notation for disulfanylmethanediol?
The canonical SMILES for disulfanylmethanediol is OC(O)SS.
What is the InChIKey of disulfanylmethanediol?
The InChIKey is BDHGBFLGXFJYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O2S2/c2-1(3)5-4/h1-4H.
What are the key properties of disulfanylmethanediol?
disulfanylmethanediol has a molecular weight of 112.17 g/mol, XLogP of -0.17, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disulfanylmethanediol is sourced from PubChem (CID 91433290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).