C4H10O2S3 — CID 54058685
(2R,3S)-4-(disulfanyl)-3-sulfanylbutane-1,2-diol (PubChem CID 54058685) has the molecular formula C4H10O2S3 and a molecular weight of 186.32 g/mol. Its IUPAC name is (2R,3S)-4-(disulfanyl)-3-sulfanylbutane-1,2-diol.
| Compound Name | (2R,3S)-4-(disulfanyl)-3-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 54058685 |
| Molecular Formula | C4H10O2S3 |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | (2R,3S)-4-(disulfanyl)-3-sulfanylbutane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](S)CSS |
| InChI | InChI=1S/C4H10O2S3/c5-1-3(6)4(7)2-9-8/h3-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | LYCBUNKPKZCJOU-QWWZWVQMSA-N |
| XLogP | 0.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|