C12H26O10S2 — CID 165358247
(2S,3R,4S,5S)-6-[[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]disulfanyl]hexane-1,2,3,4,5-pentol (PubChem CID 165358247) has the molecular formula C12H26O10S2 and a molecular weight of 394.46 g/mol. Its IUPAC name is (2S,3R,4S,5S)-6-[[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]disulfanyl]hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4S,5S)-6-[[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]disulfanyl]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 165358247 |
| Molecular Formula | C12H26O10S2 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2S,3R,4S,5S)-6-[[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]disulfanyl]hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CSSC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C12H26O10S2/c13-1-5(15)9(19)11(21)7(17)3-23-24-4-8(18)12(22)10(20)6(16)2-14/h5-22H,1-4H2/t5-,6-,7+,8+,9+,10+,11+,12+/m0/s1 |
| InChIKey | IEVBFVHXVXAKRN-JLFWRBHBSA-N |
| XLogP | -4.76 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|