C6H14O5S — CID 87766833
(2S,3R,4S,5S)-5-sulfanylhexane-1,2,3,4,6-pentol (PubChem CID 87766833) has the molecular formula C6H14O5S and a molecular weight of 198.24 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-sulfanylhexane-1,2,3,4,6-pentol.
| Compound Name | (2S,3R,4S,5S)-5-sulfanylhexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 87766833 |
| Molecular Formula | C6H14O5S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (2S,3R,4S,5S)-5-sulfanylhexane-1,2,3,4,6-pentol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](S)CO |
| InChI | InChI=1S/C6H14O5S/c7-1-3(9)5(10)6(11)4(12)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | MODFFAPSNMWPPZ-UNTFVMJOSA-N |
| XLogP | -2.65 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|