C4H10O4S2 — CID 140970562
(2S,3R)-1-(disulfanyl)butane-1,2,3,4-tetrol (PubChem CID 140970562) has the molecular formula C4H10O4S2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,3R)-1-(disulfanyl)butane-1,2,3,4-tetrol.
| Compound Name | (2S,3R)-1-(disulfanyl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 140970562 |
| Molecular Formula | C4H10O4S2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (2S,3R)-1-(disulfanyl)butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)C(O)SS |
| InChI | InChI=1S/C4H10O4S2/c5-1-2(6)3(7)4(8)10-9/h2-9H,1H2/t2-,3+,4?/m1/s1 |
| InChIKey | LFLJIOIMCPYLSA-BCDHYOAOSA-N |
| XLogP | -1.40 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|