About 1-(disulfanyl)butan-2-ol
1-(disulfanyl)butan-2-ol (PubChem CID 138559697) has the molecular formula C4H10OS2
and a molecular weight of 138.26 g/mol. Its IUPAC name is 1-(disulfanyl)butan-2-ol.
Molecular Properties
| Compound Name | 1-(disulfanyl)butan-2-ol |
| PubChem CID | 138559697 |
| Molecular Formula | C4H10OS2 |
| Molecular Weight | 138.26 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 1-(disulfanyl)butan-2-ol |
| SMILES | CCC(O)CSS |
| InChI | InChI=1S/C4H10OS2/c1-2-4(5)3-7-6/h4-6H,2-3H2,1H3 |
| InChIKey | JFENKTZQUDUNMU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)butan-2-ol?
The IUPAC name of 1-(disulfanyl)butan-2-ol (CID 138559697) is 1-(disulfanyl)butan-2-ol.
What is the SMILES notation for 1-(disulfanyl)butan-2-ol?
The canonical SMILES for 1-(disulfanyl)butan-2-ol is CCC(O)CSS.
What is the InChIKey of 1-(disulfanyl)butan-2-ol?
The InChIKey is JFENKTZQUDUNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10OS2/c1-2-4(5)3-7-6/h4-6H,2-3H2,1H3.
What are the key properties of 1-(disulfanyl)butan-2-ol?
1-(disulfanyl)butan-2-ol has a molecular weight of 138.26 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)butan-2-ol is sourced from PubChem (CID 138559697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).