C2H6O3S — CID 14440976
2-sulfanylethane-1,1,2-triol (PubChem CID 14440976) has the molecular formula C2H6O3S and a molecular weight of 110.13 g/mol. Its IUPAC name is 2-sulfanylethane-1,1,2-triol.
| Compound Name | 2-sulfanylethane-1,1,2-triol |
|---|---|
| PubChem CID | 14440976 |
| Molecular Formula | C2H6O3S |
| Molecular Weight | 110.13 g/mol |
| Exact Mass | 110.00 |
| IUPAC Name | 2-sulfanylethane-1,1,2-triol |
| SMILES | OC(O)C(O)S |
| InChI | InChI=1S/C2H6O3S/c3-1(4)2(5)6/h1-6H |
| InChIKey | INNVGQVJJLYGTO-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.13 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|