C6H18O4Zn2 — CID 59911813
dizinc;carbanide;ethane-1,1,2,2-tetrol (PubChem CID 59911813) has the molecular formula C6H18O4Zn2 and a molecular weight of 284.99 g/mol. Its IUPAC name is dizinc;carbanide;ethane-1,1,2,2-tetrol.
| Compound Name | dizinc;carbanide;ethane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 59911813 |
| Molecular Formula | C6H18O4Zn2 |
| Molecular Weight | 284.99 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | dizinc;carbanide;ethane-1,1,2,2-tetrol |
| SMILES | OC(O)C(O)O.[CH3-].[CH3-].[CH3-].[CH3-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C2H6O4.4CH3.2Zn/c3-1(4)2(5)6;;;;;;/h1-6H;4*1H3;;/q;4*-1;2*+2 |
| InChIKey | DGXDSDLYDPCAJH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.99 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|