C4H12Cu2O4+2 — CID 58811114
carbanylium;copper;ethane-1,1,2,2-tetrol (PubChem CID 58811114) has the molecular formula C4H12Cu2O4+2 and a molecular weight of 251.23 g/mol. Its IUPAC name is carbanylium;copper;ethane-1,1,2,2-tetrol.
| Compound Name | carbanylium;copper;ethane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 58811114 |
| Molecular Formula | C4H12Cu2O4+2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | carbanylium;copper;ethane-1,1,2,2-tetrol |
| SMILES | OC(O)C(O)O.[CH3+].[CH3+].[Cu].[Cu] |
| InChI | InChI=1S/C2H6O4.2CH3.2Cu/c3-1(4)2(5)6;;;;/h1-6H;2*1H3;;/q;2*+1;; |
| InChIKey | VHAAFVFEYLNSQG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|