C6H10O4 — CID 140785203
(2E,4E)-hexa-2,4-diene-1,1,6,6-tetrol (PubChem CID 140785203) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-diene-1,1,6,6-tetrol.
| Compound Name | (2E,4E)-hexa-2,4-diene-1,1,6,6-tetrol |
|---|---|
| PubChem CID | 140785203 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2E,4E)-hexa-2,4-diene-1,1,6,6-tetrol |
| SMILES | OC(O)/C=C/C=C/C(O)O |
| InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-10H/b3-1+,4-2+ |
| InChIKey | ZUELDYKEUGYUOD-ZPUQHVIOSA-N |
| XLogP | -1.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|