C10H14O2 — CID 10870472
(2E,4E,6S,7R)-6-hydroxy-7-methylnona-2,4,8-trienal (PubChem CID 10870472) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,4E,6S,7R)-6-hydroxy-7-methylnona-2,4,8-trienal.
| Compound Name | (2E,4E,6S,7R)-6-hydroxy-7-methylnona-2,4,8-trienal |
|---|---|
| PubChem CID | 10870472 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2E,4E,6S,7R)-6-hydroxy-7-methylnona-2,4,8-trienal |
| SMILES | C=C[C@@H](C)[C@@H](O)/C=C/C=C/C=O |
| InChI | InChI=1S/C10H14O2/c1-3-9(2)10(12)7-5-4-6-8-11/h3-10,12H,1H2,2H3/b6-4+,7-5+/t9-,10+/m1/s1 |
| InChIKey | JXHYGXLULHAFTN-TZFDUBSRSA-N |
| XLogP | 1.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|