C6H10O3 — CID 175147280
4,6-dihydroxyhex-2-enal (PubChem CID 175147280) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 4,6-dihydroxyhex-2-enal.
| Compound Name | 4,6-dihydroxyhex-2-enal |
|---|---|
| PubChem CID | 175147280 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4,6-dihydroxyhex-2-enal |
| SMILES | O=CC=CC(O)CCO |
| InChI | InChI=1S/C6H10O3/c7-4-1-2-6(9)3-5-8/h1-2,4,6,8-9H,3,5H2 |
| InChIKey | PVPBIUJIMRSMIW-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|