About nickel;1-sulfanylethanol
nickel;1-sulfanylethanol (PubChem CID 174917058) has the molecular formula C2H6NiOS
and a molecular weight of 136.83 g/mol. Its IUPAC name is nickel;1-sulfanylethanol.
Molecular Properties
| Compound Name | nickel;1-sulfanylethanol |
| PubChem CID | 174917058 |
| Molecular Formula | C2H6NiOS |
| Molecular Weight | 136.83 g/mol |
| Exact Mass | 135.95 |
| IUPAC Name | nickel;1-sulfanylethanol |
| SMILES | CC(O)S.[Ni] |
| InChI | InChI=1S/C2H6OS.Ni/c1-2(3)4;/h2-4H,1H3; |
| InChIKey | IFGBRAHTAJRRPH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.83 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze nickel;1-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;1-sulfanylethanol?
The IUPAC name of nickel;1-sulfanylethanol (CID 174917058) is nickel;1-sulfanylethanol.
What is the SMILES notation for nickel;1-sulfanylethanol?
The canonical SMILES for nickel;1-sulfanylethanol is CC(O)S.[Ni].
What is the InChIKey of nickel;1-sulfanylethanol?
The InChIKey is IFGBRAHTAJRRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS.Ni/c1-2(3)4;/h2-4H,1H3;.
What are the key properties of nickel;1-sulfanylethanol?
nickel;1-sulfanylethanol has a molecular weight of 136.83 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;1-sulfanylethanol is sourced from PubChem (CID 174917058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).