About 1-(sulfanylamino)ethanol
1-(sulfanylamino)ethanol (PubChem CID 57315702) has the molecular formula C2H7NOS
and a molecular weight of 93.15 g/mol. Its IUPAC name is 1-(sulfanylamino)ethanol.
Molecular Properties
| Compound Name | 1-(sulfanylamino)ethanol |
| PubChem CID | 57315702 |
| Molecular Formula | C2H7NOS |
| Molecular Weight | 93.15 g/mol |
| Exact Mass | 93.02 |
| IUPAC Name | 1-(sulfanylamino)ethanol |
| SMILES | CC(O)NS |
| InChI | InChI=1S/C2H7NOS/c1-2(4)3-5/h2-5H,1H3 |
| InChIKey | POODLWQVRKNYSR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(sulfanylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(sulfanylamino)ethanol?
The IUPAC name of 1-(sulfanylamino)ethanol (CID 57315702) is 1-(sulfanylamino)ethanol.
What is the SMILES notation for 1-(sulfanylamino)ethanol?
The canonical SMILES for 1-(sulfanylamino)ethanol is CC(O)NS.
What is the InChIKey of 1-(sulfanylamino)ethanol?
The InChIKey is POODLWQVRKNYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NOS/c1-2(4)3-5/h2-5H,1H3.
What are the key properties of 1-(sulfanylamino)ethanol?
1-(sulfanylamino)ethanol has a molecular weight of 93.15 g/mol, XLogP of -0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(sulfanylamino)ethanol is sourced from PubChem (CID 57315702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).