About 1-(methylamino)ethanol;hydroiodide
1-(methylamino)ethanol;hydroiodide (PubChem CID 173051300) has the molecular formula C3H10INO
and a molecular weight of 203.02 g/mol. Its IUPAC name is 1-(methylamino)ethanol;hydroiodide.
Molecular Properties
| Compound Name | 1-(methylamino)ethanol;hydroiodide |
| PubChem CID | 173051300 |
| Molecular Formula | C3H10INO |
| Molecular Weight | 203.02 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | 1-(methylamino)ethanol;hydroiodide |
| SMILES | CNC(C)O.I |
| InChI | InChI=1S/C3H9NO.HI/c1-3(5)4-2;/h3-5H,1-2H3;1H |
| InChIKey | MZWHCPNNZOGPKF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.02 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)ethanol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)ethanol;hydroiodide?
The IUPAC name of 1-(methylamino)ethanol;hydroiodide (CID 173051300) is 1-(methylamino)ethanol;hydroiodide.
What is the SMILES notation for 1-(methylamino)ethanol;hydroiodide?
The canonical SMILES for 1-(methylamino)ethanol;hydroiodide is CNC(C)O.I.
What is the InChIKey of 1-(methylamino)ethanol;hydroiodide?
The InChIKey is MZWHCPNNZOGPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.HI/c1-3(5)4-2;/h3-5H,1-2H3;1H.
What are the key properties of 1-(methylamino)ethanol;hydroiodide?
1-(methylamino)ethanol;hydroiodide has a molecular weight of 203.02 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)ethanol;hydroiodide is sourced from PubChem (CID 173051300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).