About (1R)-1-sulfanylethanol;2-sulfanylethanol
(1R)-1-sulfanylethanol;2-sulfanylethanol (PubChem CID 158071036) has the molecular formula C4H12O2S2
and a molecular weight of 156.27 g/mol. Its IUPAC name is (1R)-1-sulfanylethanol;2-sulfanylethanol.
Molecular Properties
| Compound Name | (1R)-1-sulfanylethanol;2-sulfanylethanol |
| PubChem CID | 158071036 |
| Molecular Formula | C4H12O2S2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | (1R)-1-sulfanylethanol;2-sulfanylethanol |
| SMILES | C[C@H](O)S.OCCS |
| InChI | InChI=1S/2C2H6OS/c1-2(3)4;3-1-2-4/h2-4H,1H3;3-4H,1-2H2/t2-;/m1./s1 |
| InChIKey | FLUZBADEVUCQAE-HSHFZTNMSA-N |
| XLogP | 0.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-sulfanylethanol;2-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-sulfanylethanol;2-sulfanylethanol?
The IUPAC name of (1R)-1-sulfanylethanol;2-sulfanylethanol (CID 158071036) is (1R)-1-sulfanylethanol;2-sulfanylethanol.
What is the SMILES notation for (1R)-1-sulfanylethanol;2-sulfanylethanol?
The canonical SMILES for (1R)-1-sulfanylethanol;2-sulfanylethanol is C[C@H](O)S.OCCS.
What is the InChIKey of (1R)-1-sulfanylethanol;2-sulfanylethanol?
The InChIKey is FLUZBADEVUCQAE-HSHFZTNMSA-N. The full InChI is InChI=1S/2C2H6OS/c1-2(3)4;3-1-2-4/h2-4H,1H3;3-4H,1-2H2/t2-;/m1./s1.
What are the key properties of (1R)-1-sulfanylethanol;2-sulfanylethanol?
(1R)-1-sulfanylethanol;2-sulfanylethanol has a molecular weight of 156.27 g/mol, XLogP of 0.16, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-sulfanylethanol;2-sulfanylethanol is sourced from PubChem (CID 158071036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).