About 1-amino-2,2-bis(sulfanyl)ethanol
1-amino-2,2-bis(sulfanyl)ethanol (PubChem CID 57063899) has the molecular formula C2H7NOS2
and a molecular weight of 125.22 g/mol. Its IUPAC name is 1-amino-2,2-bis(sulfanyl)ethanol.
Molecular Properties
| Compound Name | 1-amino-2,2-bis(sulfanyl)ethanol |
| PubChem CID | 57063899 |
| Molecular Formula | C2H7NOS2 |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.00 |
| IUPAC Name | 1-amino-2,2-bis(sulfanyl)ethanol |
| SMILES | NC(O)C(S)S |
| InChI | InChI=1S/C2H7NOS2/c3-1(4)2(5)6/h1-2,4-6H,3H2 |
| InChIKey | ZVHLNRJOYWSBLL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,2-bis(sulfanyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,2-bis(sulfanyl)ethanol?
The IUPAC name of 1-amino-2,2-bis(sulfanyl)ethanol (CID 57063899) is 1-amino-2,2-bis(sulfanyl)ethanol.
What is the SMILES notation for 1-amino-2,2-bis(sulfanyl)ethanol?
The canonical SMILES for 1-amino-2,2-bis(sulfanyl)ethanol is NC(O)C(S)S.
What is the InChIKey of 1-amino-2,2-bis(sulfanyl)ethanol?
The InChIKey is ZVHLNRJOYWSBLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NOS2/c3-1(4)2(5)6/h1-2,4-6H,3H2.
What are the key properties of 1-amino-2,2-bis(sulfanyl)ethanol?
1-amino-2,2-bis(sulfanyl)ethanol has a molecular weight of 125.22 g/mol, XLogP of -0.55, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,2-bis(sulfanyl)ethanol is sourced from PubChem (CID 57063899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).