About 2-(disulfanyl)-1,3-diiodopropane
2-(disulfanyl)-1,3-diiodopropane (PubChem CID 89401999) has the molecular formula C3H6I2S2
and a molecular weight of 360.02 g/mol. Its IUPAC name is 2-(disulfanyl)-1,3-diiodopropane.
Molecular Properties
| Compound Name | 2-(disulfanyl)-1,3-diiodopropane |
| PubChem CID | 89401999 |
| Molecular Formula | C3H6I2S2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 359.80 |
| IUPAC Name | 2-(disulfanyl)-1,3-diiodopropane |
| SMILES | SSC(CI)CI |
| InChI | InChI=1S/C3H6I2S2/c4-1-3(2-5)7-6/h3,6H,1-2H2 |
| InChIKey | NFSAOOQIVINIPY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(disulfanyl)-1,3-diiodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(disulfanyl)-1,3-diiodopropane?
The IUPAC name of 2-(disulfanyl)-1,3-diiodopropane (CID 89401999) is 2-(disulfanyl)-1,3-diiodopropane.
What is the SMILES notation for 2-(disulfanyl)-1,3-diiodopropane?
The canonical SMILES for 2-(disulfanyl)-1,3-diiodopropane is SSC(CI)CI.
What is the InChIKey of 2-(disulfanyl)-1,3-diiodopropane?
The InChIKey is NFSAOOQIVINIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6I2S2/c4-1-3(2-5)7-6/h3,6H,1-2H2.
What are the key properties of 2-(disulfanyl)-1,3-diiodopropane?
2-(disulfanyl)-1,3-diiodopropane has a molecular weight of 360.02 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(disulfanyl)-1,3-diiodopropane is sourced from PubChem (CID 89401999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).