About sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol)
sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) (PubChem CID 87203826) has the molecular formula C10H26S7
and a molecular weight of 370.79 g/mol. Its IUPAC name is sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol).
Molecular Properties
| Compound Name | sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) |
| PubChem CID | 87203826 |
| Molecular Formula | C10H26S7 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) |
| SMILES | CC(S)SC(C)CS.CC(S)SC(C)CS.S |
| InChI | InChI=1S/2C5H12S3.H2S/c2*1-4(3-6)8-5(2)7;/h2*4-7H,3H2,1-2H3;1H2 |
| InChIKey | UICGCNQYIFSRET-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol)?
The IUPAC name of sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) (CID 87203826) is sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol).
What is the SMILES notation for sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol)?
The canonical SMILES for sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) is CC(S)SC(C)CS.CC(S)SC(C)CS.S.
What is the InChIKey of sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol)?
The InChIKey is UICGCNQYIFSRET-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12S3.H2S/c2*1-4(3-6)8-5(2)7;/h2*4-7H,3H2,1-2H3;1H2.
What are the key properties of sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol)?
sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) has a molecular weight of 370.79 g/mol, XLogP of 4.74, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;bis(2-(1-sulfanylethylsulfanyl)propane-1-thiol) is sourced from PubChem (CID 87203826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).