C8H18S7 — CID 158677450
3,4-bis(2-sulfanylethylsulfanyl)butane-1,2,4-trithiol (PubChem CID 158677450) has the molecular formula C8H18S7 and a molecular weight of 338.70 g/mol. Its IUPAC name is 3,4-bis(2-sulfanylethylsulfanyl)butane-1,2,4-trithiol.
| Compound Name | 3,4-bis(2-sulfanylethylsulfanyl)butane-1,2,4-trithiol |
|---|---|
| PubChem CID | 158677450 |
| Molecular Formula | C8H18S7 |
| Molecular Weight | 338.70 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 3,4-bis(2-sulfanylethylsulfanyl)butane-1,2,4-trithiol |
| SMILES | SCCSC(S)C(SCCS)C(S)CS |
| InChI | InChI=1S/C8H18S7/c9-1-3-14-7(6(12)5-11)8(13)15-4-2-10/h6-13H,1-5H2 |
| InChIKey | IERUNEVQPPCTIB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|