C16H35S11+ — CID 172693465
[2-sulfanyl-1,2-bis(3-sulfanylpropylsulfanyl)ethyl]-(3-sulfanylpropylsulfanyl)-[1-sulfanyl-3-(2-sulfanylethylsulfanyl)propan-2-yl]sulfanium (PubChem CID 172693465) has the molecular formula C16H35S11+ and a molecular weight of 580.19 g/mol. Its IUPAC name is [2-sulfanyl-1,2-bis(3-sulfanylpropylsulfanyl)ethyl]-(3-sulfanylpropylsulfanyl)-[1-sulfanyl-3-(2-sulfanylethylsulfanyl)propan-2-yl]sulfanium.
| Compound Name | [2-sulfanyl-1,2-bis(3-sulfanylpropylsulfanyl)ethyl]-(3-sulfanylpropylsulfanyl)-[1-sulfanyl-3-(2-sulfanylethylsulfanyl)propan-2-yl]sulfanium |
|---|---|
| PubChem CID | 172693465 |
| Molecular Formula | C16H35S11+ |
| Molecular Weight | 580.19 g/mol |
| Exact Mass | 578.97 |
| IUPAC Name | [2-sulfanyl-1,2-bis(3-sulfanylpropylsulfanyl)ethyl]-(3-sulfanylpropylsulfanyl)-[1-sulfanyl-3-(2-sulfanylethylsulfanyl)propan-2-yl]sulfanium |
| SMILES | SCCCSC(S)C(SCCCS)[S+](SCCCS)C(CS)CSCCS |
| InChI | InChI=1S/C16H34S11/c17-4-1-8-24-15(22)16(25-9-2-5-18)27(26-10-3-6-19)14(12-21)13-23-11-7-20/h14-16H,1-13H2,(H5-,17,18,19,20,21,22)/p+1 |
| InChIKey | BZORSKXBIOYGBK-UHFFFAOYSA-O |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.19 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|