C13H28S9 — CID 146406075
3-[2-[2-[2-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]ethyldisulfanyl]ethylsulfanyl]ethylsulfanyl]propane-1,2-dithiol (PubChem CID 146406075) has the molecular formula C13H28S9 and a molecular weight of 472.97 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]ethyldisulfanyl]ethylsulfanyl]ethylsulfanyl]propane-1,2-dithiol.
| Compound Name | 3-[2-[2-[2-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]ethyldisulfanyl]ethylsulfanyl]ethylsulfanyl]propane-1,2-dithiol |
|---|---|
| PubChem CID | 146406075 |
| Molecular Formula | C13H28S9 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 3-[2-[2-[2-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]ethyldisulfanyl]ethylsulfanyl]ethylsulfanyl]propane-1,2-dithiol |
| SMILES | SCCSCCSCCSSCCSCCSCC(S)CS |
| InChI | InChI=1S/C13H28S9/c14-1-2-17-3-4-18-7-9-21-22-10-8-19-5-6-20-12-13(16)11-15/h13-16H,1-12H2 |
| InChIKey | OZZONHUGBNZJNA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|