C7H16S7 — CID 172838322
1,3-bis(2-sulfanylethylsulfanyl)propane-1,2,3-trithiol (PubChem CID 172838322) has the molecular formula C7H16S7 and a molecular weight of 324.67 g/mol. Its IUPAC name is 1,3-bis(2-sulfanylethylsulfanyl)propane-1,2,3-trithiol.
| Compound Name | 1,3-bis(2-sulfanylethylsulfanyl)propane-1,2,3-trithiol |
|---|---|
| PubChem CID | 172838322 |
| Molecular Formula | C7H16S7 |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | 1,3-bis(2-sulfanylethylsulfanyl)propane-1,2,3-trithiol |
| SMILES | SCCSC(S)C(S)C(S)SCCS |
| InChI | InChI=1S/C7H16S7/c8-1-3-13-6(11)5(10)7(12)14-4-2-9/h5-12H,1-4H2 |
| InChIKey | WLNLCVPZLSWPOE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|