C12H26S8 — CID 87106223
2-[3,4,4-tris(2-sulfanylethylsulfanyl)butylsulfanyl]ethanethiol (PubChem CID 87106223) has the molecular formula C12H26S8 and a molecular weight of 426.88 g/mol. Its IUPAC name is 2-[3,4,4-tris(2-sulfanylethylsulfanyl)butylsulfanyl]ethanethiol.
| Compound Name | 2-[3,4,4-tris(2-sulfanylethylsulfanyl)butylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 87106223 |
| Molecular Formula | C12H26S8 |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-[3,4,4-tris(2-sulfanylethylsulfanyl)butylsulfanyl]ethanethiol |
| SMILES | SCCSCCC(SCCS)C(SCCS)SCCS |
| InChI | InChI=1S/C12H26S8/c13-2-7-17-6-1-11(18-8-3-14)12(19-9-4-15)20-10-5-16/h11-16H,1-10H2 |
| InChIKey | QFPCPZXLNVVCKS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|