C12H26S9 — CID 154945571
5-[1,3-bis(sulfanyl)propylsulfanyl]-2,3-bis(2-sulfanylethylsulfanyl)pentane-1,4-dithiol (PubChem CID 154945571) has the molecular formula C12H26S9 and a molecular weight of 458.94 g/mol. Its IUPAC name is 5-[1,3-bis(sulfanyl)propylsulfanyl]-2,3-bis(2-sulfanylethylsulfanyl)pentane-1,4-dithiol.
| Compound Name | 5-[1,3-bis(sulfanyl)propylsulfanyl]-2,3-bis(2-sulfanylethylsulfanyl)pentane-1,4-dithiol |
|---|---|
| PubChem CID | 154945571 |
| Molecular Formula | C12H26S9 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 5-[1,3-bis(sulfanyl)propylsulfanyl]-2,3-bis(2-sulfanylethylsulfanyl)pentane-1,4-dithiol |
| SMILES | SCCSC(CS)C(SCCS)C(S)CSC(S)CCS |
| InChI | InChI=1S/C12H26S9/c13-2-1-11(18)21-8-9(17)12(20-6-4-15)10(7-16)19-5-3-14/h9-18H,1-8H2 |
| InChIKey | FOLQNPYCLDVUKX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|