C8H15NOS5 — CID 130194145
2-(2-isocyanato-2-sulfanylethyl)sulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol (PubChem CID 130194145) has the molecular formula C8H15NOS5 and a molecular weight of 301.55 g/mol. Its IUPAC name is 2-(2-isocyanato-2-sulfanylethyl)sulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol.
| Compound Name | 2-(2-isocyanato-2-sulfanylethyl)sulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
|---|---|
| PubChem CID | 130194145 |
| Molecular Formula | C8H15NOS5 |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 2-(2-isocyanato-2-sulfanylethyl)sulfanyl-3-(2-sulfanylethylsulfanyl)propane-1-thiol |
| SMILES | O=C=NC(S)CSC(CS)CSCCS |
| InChI | InChI=1S/C8H15NOS5/c10-6-9-8(13)5-15-7(3-12)4-14-2-1-11/h7-8,11-13H,1-5H2 |
| InChIKey | NZCAJGVMKMCRHD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|