C16H34S8 — CID 90895816
1-[2,3-bis[2-(2-sulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]propane-1-thiol (PubChem CID 90895816) has the molecular formula C16H34S8 and a molecular weight of 482.98 g/mol. Its IUPAC name is 1-[2,3-bis[2-(2-sulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]propane-1-thiol.
| Compound Name | 1-[2,3-bis[2-(2-sulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]propane-1-thiol |
|---|---|
| PubChem CID | 90895816 |
| Molecular Formula | C16H34S8 |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 1-[2,3-bis[2-(2-sulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]propane-1-thiol |
| SMILES | CCC(S)SCC(CSCCSCC(C)S)SCCSCC(C)S |
| InChI | InChI=1S/C16H34S8/c1-4-16(19)24-12-15(23-8-7-21-10-14(3)18)11-22-6-5-20-9-13(2)17/h13-19H,4-12H2,1-3H3 |
| InChIKey | BCIXKRXSOKJRLP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|