C11H23NS5 — CID 166651199
1-[2,3-bis(2-methylsulfanylethylsulfanyl)propylsulfanyl]aziridine (PubChem CID 166651199) has the molecular formula C11H23NS5 and a molecular weight of 329.65 g/mol. Its IUPAC name is 1-[2,3-bis(2-methylsulfanylethylsulfanyl)propylsulfanyl]aziridine.
| Compound Name | 1-[2,3-bis(2-methylsulfanylethylsulfanyl)propylsulfanyl]aziridine |
|---|---|
| PubChem CID | 166651199 |
| Molecular Formula | C11H23NS5 |
| Molecular Weight | 329.65 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-[2,3-bis(2-methylsulfanylethylsulfanyl)propylsulfanyl]aziridine |
| SMILES | CSCCSCC(CSN1CC1)SCCSC |
| InChI | InChI=1S/C11H23NS5/c1-13-5-7-15-9-11(16-8-6-14-2)10-17-12-3-4-12/h11H,3-10H2,1-2H3 |
| InChIKey | DPUNBSQYWHFVHO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|