C6H14O2S2 — CID 88843555
1-(2-methylsulfanylethylsulfanyl)propane-1,2-diol (PubChem CID 88843555) has the molecular formula C6H14O2S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-(2-methylsulfanylethylsulfanyl)propane-1,2-diol.
| Compound Name | 1-(2-methylsulfanylethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 88843555 |
| Molecular Formula | C6H14O2S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1-(2-methylsulfanylethylsulfanyl)propane-1,2-diol |
| SMILES | CSCCSC(O)C(C)O |
| InChI | InChI=1S/C6H14O2S2/c1-5(7)6(8)10-4-3-9-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | ACAGJCGIRBSATP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|