C5H12O2S — CID 87617073
1-ethylsulfanylpropane-1,2-diol (PubChem CID 87617073) has the molecular formula C5H12O2S and a molecular weight of 136.22 g/mol. Its IUPAC name is 1-ethylsulfanylpropane-1,2-diol.
| Compound Name | 1-ethylsulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 87617073 |
| Molecular Formula | C5H12O2S |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 1-ethylsulfanylpropane-1,2-diol |
| SMILES | CCSC(O)C(C)O |
| InChI | InChI=1S/C5H12O2S/c1-3-8-5(7)4(2)6/h4-7H,3H2,1-2H3 |
| InChIKey | NPXJJGUSZFHPJK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|