C8H18O2S2 — CID 88730101
1,4-bis(ethylsulfanyl)butane-1,4-diol (PubChem CID 88730101) has the molecular formula C8H18O2S2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1,4-bis(ethylsulfanyl)butane-1,4-diol.
| Compound Name | 1,4-bis(ethylsulfanyl)butane-1,4-diol |
|---|---|
| PubChem CID | 88730101 |
| Molecular Formula | C8H18O2S2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1,4-bis(ethylsulfanyl)butane-1,4-diol |
| SMILES | CCSC(O)CCC(O)SCC |
| InChI | InChI=1S/C8H18O2S2/c1-3-11-7(9)5-6-8(10)12-4-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | XLTVTQDROYCPGM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|