C14H30O2S2 — CID 154144838
2,9-bis(ethylsulfanyl)decane-1,10-diol (PubChem CID 154144838) has the molecular formula C14H30O2S2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 2,9-bis(ethylsulfanyl)decane-1,10-diol.
| Compound Name | 2,9-bis(ethylsulfanyl)decane-1,10-diol |
|---|---|
| PubChem CID | 154144838 |
| Molecular Formula | C14H30O2S2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2,9-bis(ethylsulfanyl)decane-1,10-diol |
| SMILES | CCSC(CO)CCCCCCC(CO)SCC |
| InChI | InChI=1S/C14H30O2S2/c1-3-17-13(11-15)9-7-5-6-8-10-14(12-16)18-4-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | YQHGVNVKTNFRKO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|