C13H28O7S — CID 162131152
(2S,3S,4R)-5-ethylsulfanylhexane-2,3,4-triol;(2R,3S,4S)-2,3,4-trihydroxypentanal (PubChem CID 162131152) has the molecular formula C13H28O7S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2S,3S,4R)-5-ethylsulfanylhexane-2,3,4-triol;(2R,3S,4S)-2,3,4-trihydroxypentanal.
| Compound Name | (2S,3S,4R)-5-ethylsulfanylhexane-2,3,4-triol;(2R,3S,4S)-2,3,4-trihydroxypentanal |
|---|---|
| PubChem CID | 162131152 |
| Molecular Formula | C13H28O7S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2S,3S,4R)-5-ethylsulfanylhexane-2,3,4-triol;(2R,3S,4S)-2,3,4-trihydroxypentanal |
| SMILES | CCSC(C)[C@H](O)[C@@H](O)[C@H](C)O.C[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C8H18O3S.C5H10O4/c1-4-12-6(3)8(11)7(10)5(2)9;1-3(7)5(9)4(8)2-6/h5-11H,4H2,1-3H3;2-5,7-9H,1H3/t5-,6?,7-,8-;3-,4-,5-/m00/s1 |
| InChIKey | ZIRHYRMUANIPKD-GMUWCGBRSA-N |
| XLogP | -1.48 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|