C14H30O9S2 — CID 160702351
(2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 160702351) has the molecular formula C14H30O9S2 and a molecular weight of 406.52 g/mol. Its IUPAC name is (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 160702351 |
| Molecular Formula | C14H30O9S2 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H20O4S2.C5H10O5/c1-3-14-9(15-4-2)8(13)7(12)6(11)5-10;6-1-3(8)5(10)4(9)2-7/h6-13H,3-5H2,1-2H3;1,3-5,7-10H,2H2/t6-,7-,8+;3-,4-,5+/m11/s1 |
| InChIKey | RQUADQJDUPZUKR-OOAZARDMSA-N |
| XLogP | -2.85 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|